C18H16FN3O4S — CID 53490167
methyl 3-amino-2-[2-(4-fluorophenoxy)ethylsulfanyl]-4-oxoquinazoline-7-carboxylate (PubChem CID 53490167) has the molecular formula C18H16FN3O4S and a molecular weight of 389.41 g/mol. Its IUPAC name is methyl 3-amino-2-[2-(4-fluorophenoxy)ethylsulfanyl]-4-oxoquinazoline-7-carboxylate.
| Compound Name | methyl 3-amino-2-[2-(4-fluorophenoxy)ethylsulfanyl]-4-oxoquinazoline-7-carboxylate |
|---|---|
| PubChem CID | 53490167 |
| Molecular Formula | C18H16FN3O4S |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | methyl 3-amino-2-[2-(4-fluorophenoxy)ethylsulfanyl]-4-oxoquinazoline-7-carboxylate |
| SMILES | COC(=O)c1ccc2c(=O)n(N)c(SCCOc3ccc(F)cc3)nc2c1 |
| InChI | InChI=1S/C18H16FN3O4S/c1-25-17(24)11-2-7-14-15(10-11)21-18(22(20)16(14)23)27-9-8-26-13-5-3-12(19)4-6-13/h2-7,10H,8-9,20H2,1H3 |
| InChIKey | GGUIWVQBAITILT-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|