C12H10N4O3S — CID 53490168
methyl 3-amino-2-(cyanomethylsulfanyl)-4-oxoquinazoline-7-carboxylate (PubChem CID 53490168) has the molecular formula C12H10N4O3S and a molecular weight of 290.30 g/mol. Its IUPAC name is methyl 3-amino-2-(cyanomethylsulfanyl)-4-oxoquinazoline-7-carboxylate.
| Compound Name | methyl 3-amino-2-(cyanomethylsulfanyl)-4-oxoquinazoline-7-carboxylate |
|---|---|
| PubChem CID | 53490168 |
| Molecular Formula | C12H10N4O3S |
| Molecular Weight | 290.30 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | methyl 3-amino-2-(cyanomethylsulfanyl)-4-oxoquinazoline-7-carboxylate |
| SMILES | COC(=O)c1ccc2c(=O)n(N)c(SCC#N)nc2c1 |
| InChI | InChI=1S/C12H10N4O3S/c1-19-11(18)7-2-3-8-9(6-7)15-12(20-5-4-13)16(14)10(8)17/h2-3,6H,5,14H2,1H3 |
| InChIKey | LTFOKTJAZHQRQF-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 111.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.30 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |