C23H21F3N2OS — CID 165122102
(2S)-2-amino-N-[4-benzylsulfanyl-3-(trifluoromethyl)phenyl]-3-phenylpropanamide (PubChem CID 165122102) has the molecular formula C23H21F3N2OS and a molecular weight of 430.50 g/mol. Its IUPAC name is (2S)-2-amino-N-[4-benzylsulfanyl-3-(trifluoromethyl)phenyl]-3-phenylpropanamide.
| Compound Name | (2S)-2-amino-N-[4-benzylsulfanyl-3-(trifluoromethyl)phenyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 165122102 |
| Molecular Formula | C23H21F3N2OS |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | (2S)-2-amino-N-[4-benzylsulfanyl-3-(trifluoromethyl)phenyl]-3-phenylpropanamide |
| SMILES | N[C@@H](Cc1ccccc1)C(=O)Nc1ccc(SCc2ccccc2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H21F3N2OS/c24-23(25,26)19-14-18(11-12-21(19)30-15-17-9-5-2-6-10-17)28-22(29)20(27)13-16-7-3-1-4-8-16/h1-12,14,20H,13,15,27H2,(H,28,29)/t20-/m0/s1 |
| InChIKey | OMOCFBWPMSMILS-FQEVSTJZSA-N |
| XLogP | 5.51 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |