C22H23ClN2O2S — CID 174204840
2-amino-N-(4-benzylsulfanyl-3-hydroxyphenyl)-3-phenylpropanamide;hydrochloride (PubChem CID 174204840) has the molecular formula C22H23ClN2O2S and a molecular weight of 414.96 g/mol. Its IUPAC name is 2-amino-N-(4-benzylsulfanyl-3-hydroxyphenyl)-3-phenylpropanamide;hydrochloride.
| Compound Name | 2-amino-N-(4-benzylsulfanyl-3-hydroxyphenyl)-3-phenylpropanamide;hydrochloride |
|---|---|
| PubChem CID | 174204840 |
| Molecular Formula | C22H23ClN2O2S |
| Molecular Weight | 414.96 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | 2-amino-N-(4-benzylsulfanyl-3-hydroxyphenyl)-3-phenylpropanamide;hydrochloride |
| SMILES | Cl.NC(Cc1ccccc1)C(=O)Nc1ccc(SCc2ccccc2)c(O)c1 |
| InChI | InChI=1S/C22H22N2O2S.ClH/c23-19(13-16-7-3-1-4-8-16)22(26)24-18-11-12-21(20(25)14-18)27-15-17-9-5-2-6-10-17;/h1-12,14,19,25H,13,15,23H2,(H,24,26);1H |
| InChIKey | XBEFYGHZDHHAQY-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.96 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |