C27H36N2O2S — CID 156652623
2-amino-N-(4-benzylsulfanyl-3-methoxyphenyl)-3-phenylpropanamide;ethane (PubChem CID 156652623) has the molecular formula C27H36N2O2S and a molecular weight of 452.66 g/mol. Its IUPAC name is 2-amino-N-(4-benzylsulfanyl-3-methoxyphenyl)-3-phenylpropanamide;ethane.
| Compound Name | 2-amino-N-(4-benzylsulfanyl-3-methoxyphenyl)-3-phenylpropanamide;ethane |
|---|---|
| PubChem CID | 156652623 |
| Molecular Formula | C27H36N2O2S |
| Molecular Weight | 452.66 g/mol |
| Exact Mass | 452.25 |
| IUPAC Name | 2-amino-N-(4-benzylsulfanyl-3-methoxyphenyl)-3-phenylpropanamide;ethane |
| SMILES | CC.CC.COc1cc(NC(=O)C(N)Cc2ccccc2)ccc1SCc1ccccc1 |
| InChI | InChI=1S/C23H24N2O2S.2C2H6/c1-27-21-15-19(12-13-22(21)28-16-18-10-6-3-7-11-18)25-23(26)20(24)14-17-8-4-2-5-9-17;2*1-2/h2-13,15,20H,14,16,24H2,1H3,(H,25,26);2*1-2H3 |
| InChIKey | OXNSQIGJGQLJDF-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.66 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |