C19H21ClN2O3S — CID 10194176
3-chloro-2,2-dimethyl-N-[2-[(4-methyl-3-nitrophenyl)methylsulfanyl]phenyl]propanamide (PubChem CID 10194176) has the molecular formula C19H21ClN2O3S and a molecular weight of 392.91 g/mol. Its IUPAC name is 3-chloro-2,2-dimethyl-N-[2-[(4-methyl-3-nitrophenyl)methylsulfanyl]phenyl]propanamide.
| Compound Name | 3-chloro-2,2-dimethyl-N-[2-[(4-methyl-3-nitrophenyl)methylsulfanyl]phenyl]propanamide |
|---|---|
| PubChem CID | 10194176 |
| Molecular Formula | C19H21ClN2O3S |
| Molecular Weight | 392.91 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | 3-chloro-2,2-dimethyl-N-[2-[(4-methyl-3-nitrophenyl)methylsulfanyl]phenyl]propanamide |
| SMILES | Cc1ccc(CSc2ccccc2NC(=O)C(C)(C)CCl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H21ClN2O3S/c1-13-8-9-14(10-16(13)22(24)25)11-26-17-7-5-4-6-15(17)21-18(23)19(2,3)12-20/h4-10H,11-12H2,1-3H3,(H,21,23) |
| InChIKey | ZCLRWOUODOXLBR-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.91 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|