C14H9Cl2N3O4 — CID 2525364
2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-N-(5-methyl-1,2-oxazol-3-yl)acetamide (PubChem CID 2525364) has the molecular formula C14H9Cl2N3O4 and a molecular weight of 354.15 g/mol. Its IUPAC name is 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-N-(5-methyl-1,2-oxazol-3-yl)acetamide.
| Compound Name | 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-N-(5-methyl-1,2-oxazol-3-yl)acetamide |
|---|---|
| PubChem CID | 2525364 |
| Molecular Formula | C14H9Cl2N3O4 |
| Molecular Weight | 354.15 g/mol |
| Exact Mass | 353.00 |
| IUPAC Name | 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-N-(5-methyl-1,2-oxazol-3-yl)acetamide |
| SMILES | Cc1cc(NC(=O)CN2C(=O)c3cc(Cl)c(Cl)cc3C2=O)no1 |
| InChI | InChI=1S/C14H9Cl2N3O4/c1-6-2-11(18-23-6)17-12(20)5-19-13(21)7-3-9(15)10(16)4-8(7)14(19)22/h2-4H,5H2,1H3,(H,17,18,20) |
| InChIKey | DLUCGQMCFULPRV-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.15 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|