C19H21N2O2+ — CID 9279981
(2,4-dimethylphenyl)methyl-[(1,3-dioxoisoindol-2-yl)methyl]-methylazanium (PubChem CID 9279981) has the molecular formula C19H21N2O2+ and a molecular weight of 309.39 g/mol. Its IUPAC name is (2,4-dimethylphenyl)methyl-[(1,3-dioxoisoindol-2-yl)methyl]-methylazanium.
| Compound Name | (2,4-dimethylphenyl)methyl-[(1,3-dioxoisoindol-2-yl)methyl]-methylazanium |
|---|---|
| PubChem CID | 9279981 |
| Molecular Formula | C19H21N2O2+ |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | (2,4-dimethylphenyl)methyl-[(1,3-dioxoisoindol-2-yl)methyl]-methylazanium |
| SMILES | Cc1ccc(C[NH+](C)CN2C(=O)c3ccccc3C2=O)c(C)c1 |
| InChI | InChI=1S/C19H20N2O2/c1-13-8-9-15(14(2)10-13)11-20(3)12-21-18(22)16-6-4-5-7-17(16)19(21)23/h4-10H,11-12H2,1-3H3/p+1 |
| InChIKey | XQVGNDZVEREYKW-UHFFFAOYSA-O |
| XLogP | 1.57 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|