C20H19NO4 — CID 143934002
5,6-diacetyl-2-phenylisoindole-1,3-dione;ethane (PubChem CID 143934002) has the molecular formula C20H19NO4 and a molecular weight of 337.38 g/mol. Its IUPAC name is 5,6-diacetyl-2-phenylisoindole-1,3-dione;ethane.
| Compound Name | 5,6-diacetyl-2-phenylisoindole-1,3-dione;ethane |
|---|---|
| PubChem CID | 143934002 |
| Molecular Formula | C20H19NO4 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | 5,6-diacetyl-2-phenylisoindole-1,3-dione;ethane |
| SMILES | CC.CC(=O)c1cc2c(cc1C(C)=O)C(=O)N(c1ccccc1)C2=O |
| InChI | InChI=1S/C18H13NO4.C2H6/c1-10(20)13-8-15-16(9-14(13)11(2)21)18(23)19(17(15)22)12-6-4-3-5-7-12;1-2/h3-9H,1-2H3;1-2H3 |
| InChIKey | DRSNRZMOEIYSOD-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|