C25H16N2O4 — CID 15176885
N-(1,3-dioxo-2-phenylisoindol-5-yl)-3-hydroxynaphthalene-2-carboxamide (PubChem CID 15176885) has the molecular formula C25H16N2O4 and a molecular weight of 408.41 g/mol. Its IUPAC name is N-(1,3-dioxo-2-phenylisoindol-5-yl)-3-hydroxynaphthalene-2-carboxamide.
| Compound Name | N-(1,3-dioxo-2-phenylisoindol-5-yl)-3-hydroxynaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 15176885 |
| Molecular Formula | C25H16N2O4 |
| Molecular Weight | 408.41 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | N-(1,3-dioxo-2-phenylisoindol-5-yl)-3-hydroxynaphthalene-2-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)C(=O)N(c1ccccc1)C2=O)c1cc2ccccc2cc1O |
| InChI | InChI=1S/C25H16N2O4/c28-22-13-16-7-5-4-6-15(16)12-21(22)23(29)26-17-10-11-19-20(14-17)25(31)27(24(19)30)18-8-2-1-3-9-18/h1-14,28H,(H,26,29) |
| InChIKey | RJYFWLQHKSWVMG-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.41 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|