C24H25N3O3 — CID 56569494
N-[4-[(3-hydroxynaphthalene-2-carbonyl)amino]phenyl]azepane-1-carboxamide (PubChem CID 56569494) has the molecular formula C24H25N3O3 and a molecular weight of 403.48 g/mol. Its IUPAC name is N-[4-[(3-hydroxynaphthalene-2-carbonyl)amino]phenyl]azepane-1-carboxamide.
| Compound Name | N-[4-[(3-hydroxynaphthalene-2-carbonyl)amino]phenyl]azepane-1-carboxamide |
|---|---|
| PubChem CID | 56569494 |
| Molecular Formula | C24H25N3O3 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | N-[4-[(3-hydroxynaphthalene-2-carbonyl)amino]phenyl]azepane-1-carboxamide |
| SMILES | O=C(Nc1ccc(NC(=O)N2CCCCCC2)cc1)c1cc2ccccc2cc1O |
| InChI | InChI=1S/C24H25N3O3/c28-22-16-18-8-4-3-7-17(18)15-21(22)23(29)25-19-9-11-20(12-10-19)26-24(30)27-13-5-1-2-6-14-27/h3-4,7-12,15-16,28H,1-2,5-6,13-14H2,(H,25,29)(H,26,30) |
| InChIKey | NSMLWWVFYZRPTC-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |