C24H28N2O3 — CID 91474191
3,5-dihydroxy-N-(4-piperidin-1-ylphenyl)naphthalene-2-carboxamide;ethane (PubChem CID 91474191) has the molecular formula C24H28N2O3 and a molecular weight of 392.50 g/mol. Its IUPAC name is 3,5-dihydroxy-N-(4-piperidin-1-ylphenyl)naphthalene-2-carboxamide;ethane.
| Compound Name | 3,5-dihydroxy-N-(4-piperidin-1-ylphenyl)naphthalene-2-carboxamide;ethane |
|---|---|
| PubChem CID | 91474191 |
| Molecular Formula | C24H28N2O3 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | 3,5-dihydroxy-N-(4-piperidin-1-ylphenyl)naphthalene-2-carboxamide;ethane |
| SMILES | CC.O=C(Nc1ccc(N2CCCCC2)cc1)c1cc2cccc(O)c2cc1O |
| InChI | InChI=1S/C22H22N2O3.C2H6/c25-20-6-4-5-15-13-19(21(26)14-18(15)20)22(27)23-16-7-9-17(10-8-16)24-11-2-1-3-12-24;1-2/h4-10,13-14,25-26H,1-3,11-12H2,(H,23,27);1-2H3 |
| InChIKey | KYZZQGDJOYLHPQ-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|