C19H13N3O2S — CID 169358890
(2-naphthalen-2-yl-1,3-dioxoisoindol-5-yl)thiourea (PubChem CID 169358890) has the molecular formula C19H13N3O2S and a molecular weight of 347.40 g/mol. Its IUPAC name is (2-naphthalen-2-yl-1,3-dioxoisoindol-5-yl)thiourea.
| Compound Name | (2-naphthalen-2-yl-1,3-dioxoisoindol-5-yl)thiourea |
|---|---|
| PubChem CID | 169358890 |
| Molecular Formula | C19H13N3O2S |
| Molecular Weight | 347.40 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | (2-naphthalen-2-yl-1,3-dioxoisoindol-5-yl)thiourea |
| SMILES | NC(=S)Nc1ccc2c(c1)C(=O)N(c1ccc3ccccc3c1)C2=O |
| InChI | InChI=1S/C19H13N3O2S/c20-19(25)21-13-6-8-15-16(10-13)18(24)22(17(15)23)14-7-5-11-3-1-2-4-12(11)9-14/h1-10H,(H3,20,21,25) |
| InChIKey | DENKNEQNZZXNIN-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.40 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|