C21H18N2O4 — CID 168595106
5-(2,3-dihydroxypropylamino)-2-naphthalen-2-ylisoindole-1,3-dione (PubChem CID 168595106) has the molecular formula C21H18N2O4 and a molecular weight of 362.39 g/mol. Its IUPAC name is 5-(2,3-dihydroxypropylamino)-2-naphthalen-2-ylisoindole-1,3-dione.
| Compound Name | 5-(2,3-dihydroxypropylamino)-2-naphthalen-2-ylisoindole-1,3-dione |
|---|---|
| PubChem CID | 168595106 |
| Molecular Formula | C21H18N2O4 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | 5-(2,3-dihydroxypropylamino)-2-naphthalen-2-ylisoindole-1,3-dione |
| SMILES | O=C1c2ccc(NCC(O)CO)cc2C(=O)N1c1ccc2ccccc2c1 |
| InChI | InChI=1S/C21H18N2O4/c24-12-17(25)11-22-15-6-8-18-19(10-15)21(27)23(20(18)26)16-7-5-13-3-1-2-4-14(13)9-16/h1-10,17,22,24-25H,11-12H2 |
| InChIKey | IFHADEVNLMRBAX-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|