C17H8Cl2N2O2 — CID 2168091
5,6-dichloro-2-quinolin-8-ylisoindole-1,3-dione (PubChem CID 2168091) has the molecular formula C17H8Cl2N2O2 and a molecular weight of 343.17 g/mol. Its IUPAC name is 5,6-dichloro-2-quinolin-8-ylisoindole-1,3-dione.
| Compound Name | 5,6-dichloro-2-quinolin-8-ylisoindole-1,3-dione |
|---|---|
| PubChem CID | 2168091 |
| Molecular Formula | C17H8Cl2N2O2 |
| Molecular Weight | 343.17 g/mol |
| Exact Mass | 342.00 |
| IUPAC Name | 5,6-dichloro-2-quinolin-8-ylisoindole-1,3-dione |
| SMILES | O=C1c2cc(Cl)c(Cl)cc2C(=O)N1c1cccc2cccnc12 |
| InChI | InChI=1S/C17H8Cl2N2O2/c18-12-7-10-11(8-13(12)19)17(23)21(16(10)22)14-5-1-3-9-4-2-6-20-15(9)14/h1-8H |
| InChIKey | HCRLCACFDRCPOP-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.17 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|