C24H18N4O — CID 166443239
3-(2,6-dimethylphenyl)imino-2-quinolin-8-ylpyrrolo[3,4-c]pyridin-1-one (PubChem CID 166443239) has the molecular formula C24H18N4O and a molecular weight of 378.44 g/mol. Its IUPAC name is 3-(2,6-dimethylphenyl)imino-2-quinolin-8-ylpyrrolo[3,4-c]pyridin-1-one.
| Compound Name | 3-(2,6-dimethylphenyl)imino-2-quinolin-8-ylpyrrolo[3,4-c]pyridin-1-one |
|---|---|
| PubChem CID | 166443239 |
| Molecular Formula | C24H18N4O |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | 3-(2,6-dimethylphenyl)imino-2-quinolin-8-ylpyrrolo[3,4-c]pyridin-1-one |
| SMILES | Cc1cccc(C)c1/N=C1\c2cnccc2C(=O)N1c1cccc2cccnc12 |
| InChI | InChI=1S/C24H18N4O/c1-15-6-3-7-16(2)21(15)27-23-19-14-25-13-11-18(19)24(29)28(23)20-10-4-8-17-9-5-12-26-22(17)20/h3-14H,1-2H3/b27-23+ |
| InChIKey | CHXXIWPKVXATAG-SLEBQGDGSA-N |
| XLogP | 4.99 |
| TPSA | 58.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|