C16H14N2O — CID 141397224
3,4-dimethyl-5-methylidene-1-quinolin-8-ylpyrrol-2-one (PubChem CID 141397224) has the molecular formula C16H14N2O and a molecular weight of 250.30 g/mol. Its IUPAC name is 3,4-dimethyl-5-methylidene-1-quinolin-8-ylpyrrol-2-one.
| Compound Name | 3,4-dimethyl-5-methylidene-1-quinolin-8-ylpyrrol-2-one |
|---|---|
| PubChem CID | 141397224 |
| Molecular Formula | C16H14N2O |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 3,4-dimethyl-5-methylidene-1-quinolin-8-ylpyrrol-2-one |
| SMILES | C=C1C(C)=C(C)C(=O)N1c1cccc2cccnc12 |
| InChI | InChI=1S/C16H14N2O/c1-10-11(2)16(19)18(12(10)3)14-8-4-6-13-7-5-9-17-15(13)14/h4-9H,3H2,1-2H3 |
| InChIKey | CCHWINWMZKAABV-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |