C23H13ClN2O3 — CID 1329880
4-(4-chlorophenoxy)-2-quinolin-8-ylisoindole-1,3-dione (PubChem CID 1329880) has the molecular formula C23H13ClN2O3 and a molecular weight of 400.82 g/mol. Its IUPAC name is 4-(4-chlorophenoxy)-2-quinolin-8-ylisoindole-1,3-dione.
| Compound Name | 4-(4-chlorophenoxy)-2-quinolin-8-ylisoindole-1,3-dione |
|---|---|
| PubChem CID | 1329880 |
| Molecular Formula | C23H13ClN2O3 |
| Molecular Weight | 400.82 g/mol |
| Exact Mass | 400.06 |
| IUPAC Name | 4-(4-chlorophenoxy)-2-quinolin-8-ylisoindole-1,3-dione |
| SMILES | O=C1c2cccc(Oc3ccc(Cl)cc3)c2C(=O)N1c1cccc2cccnc12 |
| InChI | InChI=1S/C23H13ClN2O3/c24-15-9-11-16(12-10-15)29-19-8-2-6-17-20(19)23(28)26(22(17)27)18-7-1-4-14-5-3-13-25-21(14)18/h1-13H |
| InChIKey | MILBPIYLHAACGX-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.82 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|