C30H24N2O2S — CID 15504984
4-(benzenesulfonyl)-2-benzyl-1-methyl-3-phenylpyrrolo[3,4-b]indole (PubChem CID 15504984) has the molecular formula C30H24N2O2S and a molecular weight of 476.60 g/mol. Its IUPAC name is 4-(benzenesulfonyl)-2-benzyl-1-methyl-3-phenylpyrrolo[3,4-b]indole.
| Compound Name | 4-(benzenesulfonyl)-2-benzyl-1-methyl-3-phenylpyrrolo[3,4-b]indole |
|---|---|
| PubChem CID | 15504984 |
| Molecular Formula | C30H24N2O2S |
| Molecular Weight | 476.60 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | 4-(benzenesulfonyl)-2-benzyl-1-methyl-3-phenylpyrrolo[3,4-b]indole |
| SMILES | Cc1c2c3ccccc3n(S(=O)(=O)c3ccccc3)c2c(-c2ccccc2)n1Cc1ccccc1 |
| InChI | InChI=1S/C30H24N2O2S/c1-22-28-26-19-11-12-20-27(26)32(35(33,34)25-17-9-4-10-18-25)30(28)29(24-15-7-3-8-16-24)31(22)21-23-13-5-2-6-14-23/h2-20H,21H2,1H3 |
| InChIKey | OLCJZJJCYKLXHI-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.60 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |