About 9-(4-methylphenyl)sulfonyl-1-phenylthiopyrano[3,4-b]indole-3-thione
9-(4-methylphenyl)sulfonyl-1-phenylthiopyrano[3,4-b]indole-3-thione (PubChem CID 50936650) has the molecular formula C24H17NO2S3
and a molecular weight of 447.61 g/mol. Its IUPAC name is 9-(4-methylphenyl)sulfonyl-1-phenylthiopyrano[3,4-b]indole-3-thione.
Molecular Properties
| Compound Name | 9-(4-methylphenyl)sulfonyl-1-phenylthiopyrano[3,4-b]indole-3-thione |
| PubChem CID | 50936650 |
| Molecular Formula | C24H17NO2S3 |
| Molecular Weight | 447.61 g/mol |
| Exact Mass | 447.04 |
| IUPAC Name | 9-(4-methylphenyl)sulfonyl-1-phenylthiopyrano[3,4-b]indole-3-thione |
| SMILES | Cc1ccc(S(=O)(=O)n2c3ccccc3c3cc(=S)sc(-c4ccccc4)c32)cc1 |
| InChI | InChI=1S/C24H17NO2S3/c1-16-11-13-18(14-12-16)30(26,27)25-21-10-6-5-9-19(21)20-15-22(28)29-24(23(20)25)17-7-3-2-4-8-17/h2-15H,1H3 |
| InChIKey | UCKANQMQWPBOMT-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 447.61 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 9-(4-methylphenyl)sulfonyl-1-phenylthiopyrano[3,4-b]indole-3-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(4-methylphenyl)sulfonyl-1-phenylthiopyrano[3,4-b]indole-3-thione?
The IUPAC name of 9-(4-methylphenyl)sulfonyl-1-phenylthiopyrano[3,4-b]indole-3-thione (CID 50936650) is 9-(4-methylphenyl)sulfonyl-1-phenylthiopyrano[3,4-b]indole-3-thione.
What is the SMILES notation for 9-(4-methylphenyl)sulfonyl-1-phenylthiopyrano[3,4-b]indole-3-thione?
The canonical SMILES for 9-(4-methylphenyl)sulfonyl-1-phenylthiopyrano[3,4-b]indole-3-thione is Cc1ccc(S(=O)(=O)n2c3ccccc3c3cc(=S)sc(-c4ccccc4)c32)cc1.
What is the InChIKey of 9-(4-methylphenyl)sulfonyl-1-phenylthiopyrano[3,4-b]indole-3-thione?
The InChIKey is UCKANQMQWPBOMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H17NO2S3/c1-16-11-13-18(14-12-16)30(26,27)25-21-10-6-5-9-19(21)20-15-22(28)29-24(23(20)25)17-7-3-2-4-8-17/h2-15H,1H3.
What are the key properties of 9-(4-methylphenyl)sulfonyl-1-phenylthiopyrano[3,4-b]indole-3-thione?
9-(4-methylphenyl)sulfonyl-1-phenylthiopyrano[3,4-b]indole-3-thione has a molecular weight of 447.61 g/mol, XLogP of 6.80, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(4-methylphenyl)sulfonyl-1-phenylthiopyrano[3,4-b]indole-3-thione is sourced from PubChem (CID 50936650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).