C27H25NO3S — CID 102141822
2-[5-methyl-1-(4-methylphenyl)sulfonyl-2-phenylindol-4-yl]cyclopentan-1-one (PubChem CID 102141822) has the molecular formula C27H25NO3S and a molecular weight of 443.57 g/mol. Its IUPAC name is 2-[5-methyl-1-(4-methylphenyl)sulfonyl-2-phenylindol-4-yl]cyclopentan-1-one.
| Compound Name | 2-[5-methyl-1-(4-methylphenyl)sulfonyl-2-phenylindol-4-yl]cyclopentan-1-one |
|---|---|
| PubChem CID | 102141822 |
| Molecular Formula | C27H25NO3S |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | 2-[5-methyl-1-(4-methylphenyl)sulfonyl-2-phenylindol-4-yl]cyclopentan-1-one |
| SMILES | Cc1ccc(S(=O)(=O)n2c(-c3ccccc3)cc3c(C4CCCC4=O)c(C)ccc32)cc1 |
| InChI | InChI=1S/C27H25NO3S/c1-18-11-14-21(15-12-18)32(30,31)28-24-16-13-19(2)27(22-9-6-10-26(22)29)23(24)17-25(28)20-7-4-3-5-8-20/h3-5,7-8,11-17,22H,6,9-10H2,1-2H3 |
| InChIKey | DEMWAPMIFNIMHW-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 56.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |