C20H17NO3S — CID 102127651
(1R,12R)-3-(4-methylphenyl)sulfonyl-15-oxa-3-azatetracyclo[10.2.1.02,10.04,9]pentadeca-2(10),4,6,8,13-pentaene (PubChem CID 102127651) has the molecular formula C20H17NO3S and a molecular weight of 351.43 g/mol. Its IUPAC name is (1R,12R)-3-(4-methylphenyl)sulfonyl-15-oxa-3-azatetracyclo[10.2.1.02,10.04,9]pentadeca-2(10),4,6,8,13-pentaene.
| Compound Name | (1R,12R)-3-(4-methylphenyl)sulfonyl-15-oxa-3-azatetracyclo[10.2.1.02,10.04,9]pentadeca-2(10),4,6,8,13-pentaene |
|---|---|
| PubChem CID | 102127651 |
| Molecular Formula | C20H17NO3S |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | (1R,12R)-3-(4-methylphenyl)sulfonyl-15-oxa-3-azatetracyclo[10.2.1.02,10.04,9]pentadeca-2(10),4,6,8,13-pentaene |
| SMILES | Cc1ccc(S(=O)(=O)n2c3c(c4ccccc42)C[C@@H]2C=C[C@H]3O2)cc1 |
| InChI | InChI=1S/C20H17NO3S/c1-13-6-9-15(10-7-13)25(22,23)21-18-5-3-2-4-16(18)17-12-14-8-11-19(24-14)20(17)21/h2-11,14,19H,12H2,1H3/t14-,19+/m0/s1 |
| InChIKey | OGUUODNWDLUIRO-IFXJQAMLSA-N |
| XLogP | 3.74 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|