C34H32N2O5S3 — CID 11734917
(1R)-18-methoxy-3-(4-methylphenyl)sulfonyl-21-(4-methylphenyl)sulfonylsulfanyl-11,12,14,21-tetrahydro-1H-yohimban (PubChem CID 11734917) has the molecular formula C34H32N2O5S3 and a molecular weight of 644.84 g/mol. Its IUPAC name is (1R)-18-methoxy-3-(4-methylphenyl)sulfonyl-21-(4-methylphenyl)sulfonylsulfanyl-11,12,14,21-tetrahydro-1H-yohimban.
| Compound Name | (1R)-18-methoxy-3-(4-methylphenyl)sulfonyl-21-(4-methylphenyl)sulfonylsulfanyl-11,12,14,21-tetrahydro-1H-yohimban |
|---|---|
| PubChem CID | 11734917 |
| Molecular Formula | C34H32N2O5S3 |
| Molecular Weight | 644.84 g/mol |
| Exact Mass | 644.15 |
| IUPAC Name | (1R)-18-methoxy-3-(4-methylphenyl)sulfonyl-21-(4-methylphenyl)sulfonylsulfanyl-11,12,14,21-tetrahydro-1H-yohimban |
| SMILES | COc1ccc2c(c1)C(SS(=O)(=O)c1ccc(C)cc1)[C@H]1c3c(c4ccccc4n3S(=O)(=O)c3ccc(C)cc3)CCN1C2 |
| InChI | InChI=1S/C34H32N2O5S3/c1-22-8-14-26(15-9-22)43(37,38)36-31-7-5-4-6-28(31)29-18-19-35-21-24-12-13-25(41-3)20-30(24)34(33(35)32(29)36)42-44(39,40)27-16-10-23(2)11-17-27/h4-17,20,33-34H,18-19,21H2,1-3H3/t33-,34?/m1/s1 |
| InChIKey | UDIMDCGTCGASOP-BONSOQDYSA-N |
| XLogP | 6.78 |
| TPSA | 85.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.84 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|