C41H37N3O3S — CID 139603380
[3-[2-(dibenzylamino)ethyl]-1-(4-methylphenyl)sulfonylindol-2-yl]-quinolin-4-ylmethanol (PubChem CID 139603380) has the molecular formula C41H37N3O3S and a molecular weight of 651.83 g/mol. Its IUPAC name is [3-[2-(dibenzylamino)ethyl]-1-(4-methylphenyl)sulfonylindol-2-yl]-quinolin-4-ylmethanol.
| Compound Name | [3-[2-(dibenzylamino)ethyl]-1-(4-methylphenyl)sulfonylindol-2-yl]-quinolin-4-ylmethanol |
|---|---|
| PubChem CID | 139603380 |
| Molecular Formula | C41H37N3O3S |
| Molecular Weight | 651.83 g/mol |
| Exact Mass | 651.26 |
| IUPAC Name | [3-[2-(dibenzylamino)ethyl]-1-(4-methylphenyl)sulfonylindol-2-yl]-quinolin-4-ylmethanol |
| SMILES | Cc1ccc(S(=O)(=O)n2c(C(O)c3ccnc4ccccc34)c(CCN(Cc3ccccc3)Cc3ccccc3)c3ccccc32)cc1 |
| InChI | InChI=1S/C41H37N3O3S/c1-30-20-22-33(23-21-30)48(46,47)44-39-19-11-9-17-35(39)36(40(44)41(45)37-24-26-42-38-18-10-8-16-34(37)38)25-27-43(28-31-12-4-2-5-13-31)29-32-14-6-3-7-15-32/h2-24,26,41,45H,25,27-29H2,1H3 |
| InChIKey | ZXNSIPOTCICPJF-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.83 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |