C30H24N2O6S2 — CID 10603182
[1-(benzenesulfonyl)indol-2-yl]-[1-(benzenesulfonyl)-5-methoxyindol-2-yl]methanol (PubChem CID 10603182) has the molecular formula C30H24N2O6S2 and a molecular weight of 572.66 g/mol. Its IUPAC name is [1-(benzenesulfonyl)indol-2-yl]-[1-(benzenesulfonyl)-5-methoxyindol-2-yl]methanol.
| Compound Name | [1-(benzenesulfonyl)indol-2-yl]-[1-(benzenesulfonyl)-5-methoxyindol-2-yl]methanol |
|---|---|
| PubChem CID | 10603182 |
| Molecular Formula | C30H24N2O6S2 |
| Molecular Weight | 572.66 g/mol |
| Exact Mass | 572.11 |
| IUPAC Name | [1-(benzenesulfonyl)indol-2-yl]-[1-(benzenesulfonyl)-5-methoxyindol-2-yl]methanol |
| SMILES | COc1ccc2c(c1)cc(C(O)c1cc3ccccc3n1S(=O)(=O)c1ccccc1)n2S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C30H24N2O6S2/c1-38-23-16-17-27-22(18-23)20-29(32(27)40(36,37)25-13-6-3-7-14-25)30(33)28-19-21-10-8-9-15-26(21)31(28)39(34,35)24-11-4-2-5-12-24/h2-20,30,33H,1H3 |
| InChIKey | WJCDBGQYMUPALV-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 107.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.66 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |