C30H32N2O4S — CID 164546961
[1-(benzenesulfonyl)indol-2-yl]-[(3E,4R)-3-ethylidene-1-[(4-methoxyphenyl)methyl]piperidin-4-yl]methanol (PubChem CID 164546961) has the molecular formula C30H32N2O4S and a molecular weight of 516.66 g/mol. Its IUPAC name is [1-(benzenesulfonyl)indol-2-yl]-[(3E,4R)-3-ethylidene-1-[(4-methoxyphenyl)methyl]piperidin-4-yl]methanol.
| Compound Name | [1-(benzenesulfonyl)indol-2-yl]-[(3E,4R)-3-ethylidene-1-[(4-methoxyphenyl)methyl]piperidin-4-yl]methanol |
|---|---|
| PubChem CID | 164546961 |
| Molecular Formula | C30H32N2O4S |
| Molecular Weight | 516.66 g/mol |
| Exact Mass | 516.21 |
| IUPAC Name | [1-(benzenesulfonyl)indol-2-yl]-[(3E,4R)-3-ethylidene-1-[(4-methoxyphenyl)methyl]piperidin-4-yl]methanol |
| SMILES | C/C=C1/CN(Cc2ccc(OC)cc2)CC[C@H]1C(O)c1cc2ccccc2n1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C30H32N2O4S/c1-3-23-21-31(20-22-13-15-25(36-2)16-14-22)18-17-27(23)30(33)29-19-24-9-7-8-12-28(24)32(29)37(34,35)26-10-5-4-6-11-26/h3-16,19,27,30,33H,17-18,20-21H2,1-2H3/b23-3-/t27-,30?/m1/s1 |
| InChIKey | FHCJAAIHGFAQPS-VKNZJUOBSA-N |
| XLogP | 5.39 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.66 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|