C25H26N2O2 — CID 54120438
2-[(1-benzylpiperidin-4-yl)methylidene]-6-methoxy-1H-pyrrolo[1,2-a]indol-3-one (PubChem CID 54120438) has the molecular formula C25H26N2O2 and a molecular weight of 386.50 g/mol. Its IUPAC name is 2-[(1-benzylpiperidin-4-yl)methylidene]-6-methoxy-1H-pyrrolo[1,2-a]indol-3-one.
| Compound Name | 2-[(1-benzylpiperidin-4-yl)methylidene]-6-methoxy-1H-pyrrolo[1,2-a]indol-3-one |
|---|---|
| PubChem CID | 54120438 |
| Molecular Formula | C25H26N2O2 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | 2-[(1-benzylpiperidin-4-yl)methylidene]-6-methoxy-1H-pyrrolo[1,2-a]indol-3-one |
| SMILES | COc1ccc2c(c1)cc1n2CC(=CC2CCN(Cc3ccccc3)CC2)C1=O |
| InChI | InChI=1S/C25H26N2O2/c1-29-22-7-8-23-20(14-22)15-24-25(28)21(17-27(23)24)13-18-9-11-26(12-10-18)16-19-5-3-2-4-6-19/h2-8,13-15,18H,9-12,16-17H2,1H3 |
| InChIKey | NNHYWVLLIJBGHV-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|