About 2-benzyl-8-methoxy-N-methyl-3,4-dihydropyrazino[1,2-a]indol-1-imine chloride
2-benzyl-8-methoxy-N-methyl-3,4-dihydropyrazino[1,2-a]indol-1-imine chloride (PubChem CID 53314523) has the molecular formula C20H21ClN3O-
and a molecular weight of 354.86 g/mol. Its IUPAC name is 2-benzyl-8-methoxy-N-methyl-3,4-dihydropyrazino[1,2-a]indol-1-imine chloride.
Molecular Properties
| Compound Name | 2-benzyl-8-methoxy-N-methyl-3,4-dihydropyrazino[1,2-a]indol-1-imine chloride |
| PubChem CID | 53314523 |
| Molecular Formula | C20H21ClN3O- |
| Molecular Weight | 354.86 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | 2-benzyl-8-methoxy-N-methyl-3,4-dihydropyrazino[1,2-a]indol-1-imine chloride |
| SMILES | C/N=C1/c2cc3cc(OC)ccc3n2CCN1Cc1ccccc1.[Cl-] |
| InChI | InChI=1S/C20H21N3O.ClH/c1-21-20-19-13-16-12-17(24-2)8-9-18(16)23(19)11-10-22(20)14-15-6-4-3-5-7-15;/h3-9,12-13H,10-11,14H2,1-2H3;1H/p-1/b21-20-; |
| InChIKey | RACDULSMGFQTER-CFRCJOIHSA-M |
| XLogP | 0.55 |
| TPSA | 29.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.86 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-benzyl-8-methoxy-N-methyl-3,4-dihydropyrazino[1,2-a]indol-1-imine chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-8-methoxy-N-methyl-3,4-dihydropyrazino[1,2-a]indol-1-imine chloride?
The IUPAC name of 2-benzyl-8-methoxy-N-methyl-3,4-dihydropyrazino[1,2-a]indol-1-imine chloride (CID 53314523) is 2-benzyl-8-methoxy-N-methyl-3,4-dihydropyrazino[1,2-a]indol-1-imine chloride.
What is the SMILES notation for 2-benzyl-8-methoxy-N-methyl-3,4-dihydropyrazino[1,2-a]indol-1-imine chloride?
The canonical SMILES for 2-benzyl-8-methoxy-N-methyl-3,4-dihydropyrazino[1,2-a]indol-1-imine chloride is C/N=C1/c2cc3cc(OC)ccc3n2CCN1Cc1ccccc1.[Cl-].
What is the InChIKey of 2-benzyl-8-methoxy-N-methyl-3,4-dihydropyrazino[1,2-a]indol-1-imine chloride?
The InChIKey is RACDULSMGFQTER-CFRCJOIHSA-M. The full InChI is InChI=1S/C20H21N3O.ClH/c1-21-20-19-13-16-12-17(24-2)8-9-18(16)23(19)11-10-22(20)14-15-6-4-3-5-7-15;/h3-9,12-13H,10-11,14H2,1-2H3;1H/p-1/b21-20-;.
What are the key properties of 2-benzyl-8-methoxy-N-methyl-3,4-dihydropyrazino[1,2-a]indol-1-imine chloride?
2-benzyl-8-methoxy-N-methyl-3,4-dihydropyrazino[1,2-a]indol-1-imine chloride has a molecular weight of 354.86 g/mol, XLogP of 0.55, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-8-methoxy-N-methyl-3,4-dihydropyrazino[1,2-a]indol-1-imine chloride is sourced from PubChem (CID 53314523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).