C18H22N2O3S — CID 175211825
4-benzyl-1-ethylsulfonyl-6-methoxy-2,3-dihydroquinoxaline (PubChem CID 175211825) has the molecular formula C18H22N2O3S and a molecular weight of 346.45 g/mol. Its IUPAC name is 4-benzyl-1-ethylsulfonyl-6-methoxy-2,3-dihydroquinoxaline.
| Compound Name | 4-benzyl-1-ethylsulfonyl-6-methoxy-2,3-dihydroquinoxaline |
|---|---|
| PubChem CID | 175211825 |
| Molecular Formula | C18H22N2O3S |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 4-benzyl-1-ethylsulfonyl-6-methoxy-2,3-dihydroquinoxaline |
| SMILES | CCS(=O)(=O)N1CCN(Cc2ccccc2)c2cc(OC)ccc21 |
| InChI | InChI=1S/C18H22N2O3S/c1-3-24(21,22)20-12-11-19(14-15-7-5-4-6-8-15)18-13-16(23-2)9-10-17(18)20/h4-10,13H,3,11-12,14H2,1-2H3 |
| InChIKey | DGCQIGGBFSMJSF-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |