C22H20F2N2O3S — CID 175205026
4-benzyl-1-(2,6-difluorophenyl)sulfonyl-6-methoxy-2,3-dihydroquinoxaline (PubChem CID 175205026) has the molecular formula C22H20F2N2O3S and a molecular weight of 430.48 g/mol. Its IUPAC name is 4-benzyl-1-(2,6-difluorophenyl)sulfonyl-6-methoxy-2,3-dihydroquinoxaline.
| Compound Name | 4-benzyl-1-(2,6-difluorophenyl)sulfonyl-6-methoxy-2,3-dihydroquinoxaline |
|---|---|
| PubChem CID | 175205026 |
| Molecular Formula | C22H20F2N2O3S |
| Molecular Weight | 430.48 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | 4-benzyl-1-(2,6-difluorophenyl)sulfonyl-6-methoxy-2,3-dihydroquinoxaline |
| SMILES | COc1ccc2c(c1)N(Cc1ccccc1)CCN2S(=O)(=O)c1c(F)cccc1F |
| InChI | InChI=1S/C22H20F2N2O3S/c1-29-17-10-11-20-21(14-17)25(15-16-6-3-2-4-7-16)12-13-26(20)30(27,28)22-18(23)8-5-9-19(22)24/h2-11,14H,12-13,15H2,1H3 |
| InChIKey | ZVYYFFLUVFUZOC-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.48 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |