C18H21NO4S — CID 110636787
6-methoxy-1-(2-phenylethylsulfonyl)-3,4-dihydro-2H-quinolin-4-ol (PubChem CID 110636787) has the molecular formula C18H21NO4S and a molecular weight of 347.44 g/mol. Its IUPAC name is 6-methoxy-1-(2-phenylethylsulfonyl)-3,4-dihydro-2H-quinolin-4-ol.
| Compound Name | 6-methoxy-1-(2-phenylethylsulfonyl)-3,4-dihydro-2H-quinolin-4-ol |
|---|---|
| PubChem CID | 110636787 |
| Molecular Formula | C18H21NO4S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | 6-methoxy-1-(2-phenylethylsulfonyl)-3,4-dihydro-2H-quinolin-4-ol |
| SMILES | COc1ccc2c(c1)C(O)CCN2S(=O)(=O)CCc1ccccc1 |
| InChI | InChI=1S/C18H21NO4S/c1-23-15-7-8-17-16(13-15)18(20)9-11-19(17)24(21,22)12-10-14-5-3-2-4-6-14/h2-8,13,18,20H,9-12H2,1H3 |
| InChIKey | IQQNGDQWIDLLGQ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |