C17H18N2O3 — CID 110636695
4-hydroxy-6-methoxy-N-phenyl-3,4-dihydro-2H-quinoline-1-carboxamide (PubChem CID 110636695) has the molecular formula C17H18N2O3 and a molecular weight of 298.34 g/mol. Its IUPAC name is 4-hydroxy-6-methoxy-N-phenyl-3,4-dihydro-2H-quinoline-1-carboxamide.
| Compound Name | 4-hydroxy-6-methoxy-N-phenyl-3,4-dihydro-2H-quinoline-1-carboxamide |
|---|---|
| PubChem CID | 110636695 |
| Molecular Formula | C17H18N2O3 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 4-hydroxy-6-methoxy-N-phenyl-3,4-dihydro-2H-quinoline-1-carboxamide |
| SMILES | COc1ccc2c(c1)C(O)CCN2C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C17H18N2O3/c1-22-13-7-8-15-14(11-13)16(20)9-10-19(15)17(21)18-12-5-3-2-4-6-12/h2-8,11,16,20H,9-10H2,1H3,(H,18,21) |
| InChIKey | BZPCRACPCIAMLG-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |