C26H28N2O3 — CID 67806738
(2E)-2-[(1-benzylpiperidin-4-yl)methylidene]-6,7-dimethoxy-1,4-dihydrocyclopenta[b]indol-3-one (PubChem CID 67806738) has the molecular formula C26H28N2O3 and a molecular weight of 416.52 g/mol. Its IUPAC name is (2E)-2-[(1-benzylpiperidin-4-yl)methylidene]-6,7-dimethoxy-1,4-dihydrocyclopenta[b]indol-3-one.
| Compound Name | (2E)-2-[(1-benzylpiperidin-4-yl)methylidene]-6,7-dimethoxy-1,4-dihydrocyclopenta[b]indol-3-one |
|---|---|
| PubChem CID | 67806738 |
| Molecular Formula | C26H28N2O3 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | (2E)-2-[(1-benzylpiperidin-4-yl)methylidene]-6,7-dimethoxy-1,4-dihydrocyclopenta[b]indol-3-one |
| SMILES | COc1cc2[nH]c3c(c2cc1OC)C/C(=C\C1CCN(Cc2ccccc2)CC1)C3=O |
| InChI | InChI=1S/C26H28N2O3/c1-30-23-14-20-21-13-19(26(29)25(21)27-22(20)15-24(23)31-2)12-17-8-10-28(11-9-17)16-18-6-4-3-5-7-18/h3-7,12,14-15,17,27H,8-11,13,16H2,1-2H3/b19-12+ |
| InChIKey | VXEPZTCDBFPUAO-XDHOZWIPSA-N |
| XLogP | 4.76 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|