C26H29NO4 — CID 11560788
2-[(E)-3-(1-benzylpiperidin-4-yl)prop-2-enyl]-5,6-dimethoxyindene-1,3-dione (PubChem CID 11560788) has the molecular formula C26H29NO4 and a molecular weight of 419.52 g/mol. Its IUPAC name is 2-[(E)-3-(1-benzylpiperidin-4-yl)prop-2-enyl]-5,6-dimethoxyindene-1,3-dione.
| Compound Name | 2-[(E)-3-(1-benzylpiperidin-4-yl)prop-2-enyl]-5,6-dimethoxyindene-1,3-dione |
|---|---|
| PubChem CID | 11560788 |
| Molecular Formula | C26H29NO4 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | 2-[(E)-3-(1-benzylpiperidin-4-yl)prop-2-enyl]-5,6-dimethoxyindene-1,3-dione |
| SMILES | COc1cc2c(cc1OC)C(=O)C(C/C=C/C1CCN(Cc3ccccc3)CC1)C2=O |
| InChI | InChI=1S/C26H29NO4/c1-30-23-15-21-22(16-24(23)31-2)26(29)20(25(21)28)10-6-9-18-11-13-27(14-12-18)17-19-7-4-3-5-8-19/h3-9,15-16,18,20H,10-14,17H2,1-2H3/b9-6+ |
| InChIKey | NDESXEIGXOJQIM-RMKNXTFCSA-N |
| XLogP | 4.56 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|