C25H28N2O2 — CID 19927818
2-[(1-benzylpiperidin-4-yl)methyl]-5-methoxy-2,4-dihydro-1H-cyclopenta[b]indol-3-one (PubChem CID 19927818) has the molecular formula C25H28N2O2 and a molecular weight of 388.51 g/mol. Its IUPAC name is 2-[(1-benzylpiperidin-4-yl)methyl]-5-methoxy-2,4-dihydro-1H-cyclopenta[b]indol-3-one.
| Compound Name | 2-[(1-benzylpiperidin-4-yl)methyl]-5-methoxy-2,4-dihydro-1H-cyclopenta[b]indol-3-one |
|---|---|
| PubChem CID | 19927818 |
| Molecular Formula | C25H28N2O2 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | 2-[(1-benzylpiperidin-4-yl)methyl]-5-methoxy-2,4-dihydro-1H-cyclopenta[b]indol-3-one |
| SMILES | COc1cccc2c3c([nH]c12)C(=O)C(CC1CCN(Cc2ccccc2)CC1)C3 |
| InChI | InChI=1S/C25H28N2O2/c1-29-22-9-5-8-20-21-15-19(25(28)24(21)26-23(20)22)14-17-10-12-27(13-11-17)16-18-6-3-2-4-7-18/h2-9,17,19,26H,10-16H2,1H3 |
| InChIKey | HMHDJCQWEKBSDP-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|