C31H28N2O2 — CID 54356691
4-benzoyl-2-[(1-benzylpiperidin-4-yl)methylidene]-1H-cyclopenta[b]indol-3-one (PubChem CID 54356691) has the molecular formula C31H28N2O2 and a molecular weight of 460.58 g/mol. Its IUPAC name is 4-benzoyl-2-[(1-benzylpiperidin-4-yl)methylidene]-1H-cyclopenta[b]indol-3-one.
| Compound Name | 4-benzoyl-2-[(1-benzylpiperidin-4-yl)methylidene]-1H-cyclopenta[b]indol-3-one |
|---|---|
| PubChem CID | 54356691 |
| Molecular Formula | C31H28N2O2 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.22 |
| IUPAC Name | 4-benzoyl-2-[(1-benzylpiperidin-4-yl)methylidene]-1H-cyclopenta[b]indol-3-one |
| SMILES | O=C1C(=CC2CCN(Cc3ccccc3)CC2)Cc2c1n(C(=O)c1ccccc1)c1ccccc21 |
| InChI | InChI=1S/C31H28N2O2/c34-30-25(19-22-15-17-32(18-16-22)21-23-9-3-1-4-10-23)20-27-26-13-7-8-14-28(26)33(29(27)30)31(35)24-11-5-2-6-12-24/h1-14,19,22H,15-18,20-21H2 |
| InChIKey | UJPCIWVHZAUQSJ-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|