C28H36N2O3P+ — CID 175036275
bis[(E)-2-(1-benzylpiperidin-4-yl)ethenoxy]-oxophosphanium (PubChem CID 175036275) has the molecular formula C28H36N2O3P+ and a molecular weight of 479.58 g/mol. Its IUPAC name is bis[(E)-2-(1-benzylpiperidin-4-yl)ethenoxy]-oxophosphanium.
| Compound Name | bis[(E)-2-(1-benzylpiperidin-4-yl)ethenoxy]-oxophosphanium |
|---|---|
| PubChem CID | 175036275 |
| Molecular Formula | C28H36N2O3P+ |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.25 |
| IUPAC Name | bis[(E)-2-(1-benzylpiperidin-4-yl)ethenoxy]-oxophosphanium |
| SMILES | O=[P+](O/C=C/C1CCN(Cc2ccccc2)CC1)O/C=C/C1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C28H36N2O3P/c31-34(32-21-15-25-11-17-29(18-12-25)23-27-7-3-1-4-8-27)33-22-16-26-13-19-30(20-14-26)24-28-9-5-2-6-10-28/h1-10,15-16,21-22,25-26H,11-14,17-20,23-24H2/q+1/b21-15+,22-16+ |
| InChIKey | LNCDYJNTQLMAOZ-YHARCJFQSA-N |
| XLogP | 6.53 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|