C21H22BrNO — CID 175477502
3-(1-benzylpiperidin-4-yl)-1-(4-bromophenyl)prop-2-en-1-one (PubChem CID 175477502) has the molecular formula C21H22BrNO and a molecular weight of 384.32 g/mol. Its IUPAC name is 3-(1-benzylpiperidin-4-yl)-1-(4-bromophenyl)prop-2-en-1-one.
| Compound Name | 3-(1-benzylpiperidin-4-yl)-1-(4-bromophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 175477502 |
| Molecular Formula | C21H22BrNO |
| Molecular Weight | 384.32 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | 3-(1-benzylpiperidin-4-yl)-1-(4-bromophenyl)prop-2-en-1-one |
| SMILES | O=C(C=CC1CCN(Cc2ccccc2)CC1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C21H22BrNO/c22-20-9-7-19(8-10-20)21(24)11-6-17-12-14-23(15-13-17)16-18-4-2-1-3-5-18/h1-11,17H,12-16H2 |
| InChIKey | LTRMMSNJTDITNF-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.32 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|