C27H30N4O — CID 70281720
(E)-3-(1-benzylpiperidin-4-yl)-1-[4-[(5,6-dimethylpyrimidin-4-yl)amino]phenyl]prop-2-en-1-one (PubChem CID 70281720) has the molecular formula C27H30N4O and a molecular weight of 426.56 g/mol. Its IUPAC name is (E)-3-(1-benzylpiperidin-4-yl)-1-[4-[(5,6-dimethylpyrimidin-4-yl)amino]phenyl]prop-2-en-1-one.
| Compound Name | (E)-3-(1-benzylpiperidin-4-yl)-1-[4-[(5,6-dimethylpyrimidin-4-yl)amino]phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 70281720 |
| Molecular Formula | C27H30N4O |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | (E)-3-(1-benzylpiperidin-4-yl)-1-[4-[(5,6-dimethylpyrimidin-4-yl)amino]phenyl]prop-2-en-1-one |
| SMILES | Cc1ncnc(Nc2ccc(C(=O)/C=C/C3CCN(Cc4ccccc4)CC3)cc2)c1C |
| InChI | InChI=1S/C27H30N4O/c1-20-21(2)28-19-29-27(20)30-25-11-9-24(10-12-25)26(32)13-8-22-14-16-31(17-15-22)18-23-6-4-3-5-7-23/h3-13,19,22H,14-18H2,1-2H3,(H,28,29,30)/b13-8+ |
| InChIKey | CSSYETKDJAGZID-MDWZMJQESA-N |
| XLogP | 5.49 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|