C28H27N3O4 — CID 70141428
N-[4-[3-(1-benzylpiperidin-4-yl)prop-2-enoyl]-2-nitrophenyl]benzamide (PubChem CID 70141428) has the molecular formula C28H27N3O4 and a molecular weight of 469.54 g/mol. Its IUPAC name is N-[4-[3-(1-benzylpiperidin-4-yl)prop-2-enoyl]-2-nitrophenyl]benzamide.
| Compound Name | N-[4-[3-(1-benzylpiperidin-4-yl)prop-2-enoyl]-2-nitrophenyl]benzamide |
|---|---|
| PubChem CID | 70141428 |
| Molecular Formula | C28H27N3O4 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | N-[4-[3-(1-benzylpiperidin-4-yl)prop-2-enoyl]-2-nitrophenyl]benzamide |
| SMILES | O=C(C=CC1CCN(Cc2ccccc2)CC1)c1ccc(NC(=O)c2ccccc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C28H27N3O4/c32-27(14-11-21-15-17-30(18-16-21)20-22-7-3-1-4-8-22)24-12-13-25(26(19-24)31(34)35)29-28(33)23-9-5-2-6-10-23/h1-14,19,21H,15-18,20H2,(H,29,33) |
| InChIKey | VZQUIXQSIAUWDO-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|