C23H25F2NO — CID 166444954
(E)-5-(1-benzylpiperidin-4-yl)-2,2-difluoro-1-phenylpent-4-en-1-one (PubChem CID 166444954) has the molecular formula C23H25F2NO and a molecular weight of 369.46 g/mol. Its IUPAC name is (E)-5-(1-benzylpiperidin-4-yl)-2,2-difluoro-1-phenylpent-4-en-1-one.
| Compound Name | (E)-5-(1-benzylpiperidin-4-yl)-2,2-difluoro-1-phenylpent-4-en-1-one |
|---|---|
| PubChem CID | 166444954 |
| Molecular Formula | C23H25F2NO |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | (E)-5-(1-benzylpiperidin-4-yl)-2,2-difluoro-1-phenylpent-4-en-1-one |
| SMILES | O=C(c1ccccc1)C(F)(F)C/C=C/C1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C23H25F2NO/c24-23(25,22(27)21-11-5-2-6-12-21)15-7-10-19-13-16-26(17-14-19)18-20-8-3-1-4-9-20/h1-12,19H,13-18H2/b10-7+ |
| InChIKey | PKLSDQZMRQCRAV-JXMROGBWSA-N |
| XLogP | 5.36 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|