C25H24O4 — CID 71113166
methyl 1-[4-[[3-[hydroxy(phenyl)methyl]phenoxy]methyl]phenyl]cyclopropane-1-carboxylate (PubChem CID 71113166) has the molecular formula C25H24O4 and a molecular weight of 388.46 g/mol. Its IUPAC name is methyl 1-[4-[[3-[hydroxy(phenyl)methyl]phenoxy]methyl]phenyl]cyclopropane-1-carboxylate.
| Compound Name | methyl 1-[4-[[3-[hydroxy(phenyl)methyl]phenoxy]methyl]phenyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 71113166 |
| Molecular Formula | C25H24O4 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | methyl 1-[4-[[3-[hydroxy(phenyl)methyl]phenoxy]methyl]phenyl]cyclopropane-1-carboxylate |
| SMILES | COC(=O)C1(c2ccc(COc3cccc(C(O)c4ccccc4)c3)cc2)CC1 |
| InChI | InChI=1S/C25H24O4/c1-28-24(27)25(14-15-25)21-12-10-18(11-13-21)17-29-22-9-5-8-20(16-22)23(26)19-6-3-2-4-7-19/h2-13,16,23,26H,14-15,17H2,1H3 |
| InChIKey | GWEDOIUAOVTUPB-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |