methyl 4-[[3-[(1S)-1-phenylethyl]phenoxy]methyl]benzoate

C23H22O3 — CID 144638944

IUPACmethyl 4-[[3-[(1S)-1-phenylethyl]phenoxy]methyl]benzoate
SMILESCOC(=O)c1ccc(COc2cccc([C@@H](C)c3ccccc3)c2)cc1
InChIInChI=1S/C23H22O3/c1-17(19-7-4-3-5-8-19)21-9-6-10-22(15-21)26-16-18-11-13-20(14-12-18)23(24)25-2/h3-15,17H,16H2,1-2H3/t17-/m0/s1
InChIKeyLJMAPWPFTHKMBR-KRWDZBQOSA-N
MW346.43 g/mol
LogP5.20
Rot. Bonds6

About methyl 4-[[3-[(1S)-1-phenylethyl]phenoxy]methyl]benzoate

methyl 4-[[3-[(1S)-1-phenylethyl]phenoxy]methyl]benzoate (PubChem CID 144638944) has the molecular formula C23H22O3 and a molecular weight of 346.43 g/mol. Its IUPAC name is methyl 4-[[3-[(1S)-1-phenylethyl]phenoxy]methyl]benzoate.

Molecular Properties

Compound Namemethyl 4-[[3-[(1S)-1-phenylethyl]phenoxy]methyl]benzoate
PubChem CID144638944
Molecular FormulaC23H22O3
Molecular Weight346.43 g/mol
Exact Mass346.16
IUPAC Namemethyl 4-[[3-[(1S)-1-phenylethyl]phenoxy]methyl]benzoate
SMILESCOC(=O)c1ccc(COc2cccc([C@@H](C)c3ccccc3)c2)cc1
InChIInChI=1S/C23H22O3/c1-17(19-7-4-3-5-8-19)21-9-6-10-22(15-21)26-16-18-11-13-20(14-12-18)23(24)25-2/h3-15,17H,16H2,1-2H3/t17-/m0/s1
InChIKeyLJMAPWPFTHKMBR-KRWDZBQOSA-N
XLogP5.20
TPSA35.53 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms26
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500346.43
LogP ≤ 55.20
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 4-[[3-[(1S)-1-phenylethyl]phenoxy]methyl]benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-[[3-[(1S)-1-phenylethyl]phenoxy]methyl]benzoate?
The IUPAC name of methyl 4-[[3-[(1S)-1-phenylethyl]phenoxy]methyl]benzoate (CID 144638944) is methyl 4-[[3-[(1S)-1-phenylethyl]phenoxy]methyl]benzoate.
What is the SMILES notation for methyl 4-[[3-[(1S)-1-phenylethyl]phenoxy]methyl]benzoate?
The canonical SMILES for methyl 4-[[3-[(1S)-1-phenylethyl]phenoxy]methyl]benzoate is COC(=O)c1ccc(COc2cccc([C@@H](C)c3ccccc3)c2)cc1.
What is the InChIKey of methyl 4-[[3-[(1S)-1-phenylethyl]phenoxy]methyl]benzoate?
The InChIKey is LJMAPWPFTHKMBR-KRWDZBQOSA-N. The full InChI is InChI=1S/C23H22O3/c1-17(19-7-4-3-5-8-19)21-9-6-10-22(15-21)26-16-18-11-13-20(14-12-18)23(24)25-2/h3-15,17H,16H2,1-2H3/t17-/m0/s1.
What are the key properties of methyl 4-[[3-[(1S)-1-phenylethyl]phenoxy]methyl]benzoate?
methyl 4-[[3-[(1S)-1-phenylethyl]phenoxy]methyl]benzoate has a molecular weight of 346.43 g/mol, XLogP of 5.20, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[[3-[(1S)-1-phenylethyl]phenoxy]methyl]benzoate is sourced from PubChem (CID 144638944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).