methyl 3-(1-cyanopropyl)-5-phenylmethoxybenzoate

C19H19NO3 — CID 91040171

IUPACmethyl 3-(1-cyanopropyl)-5-phenylmethoxybenzoate
SMILESCCC(C#N)c1cc(OCc2ccccc2)cc(C(=O)OC)c1
InChIInChI=1S/C19H19NO3/c1-3-15(12-20)16-9-17(19(21)22-2)11-18(10-16)23-13-14-7-5-4-6-8-14/h4-11,15H,3,13H2,1-2H3
InChIKeyMHWPLYUOTCVCSV-UHFFFAOYSA-N
MW309.37 g/mol
LogP4.07
Rot. Bonds6

About methyl 3-(1-cyanopropyl)-5-phenylmethoxybenzoate

methyl 3-(1-cyanopropyl)-5-phenylmethoxybenzoate (PubChem CID 91040171) has the molecular formula C19H19NO3 and a molecular weight of 309.37 g/mol. Its IUPAC name is methyl 3-(1-cyanopropyl)-5-phenylmethoxybenzoate.

Molecular Properties

Compound Namemethyl 3-(1-cyanopropyl)-5-phenylmethoxybenzoate
PubChem CID91040171
Molecular FormulaC19H19NO3
Molecular Weight309.37 g/mol
Exact Mass309.14
IUPAC Namemethyl 3-(1-cyanopropyl)-5-phenylmethoxybenzoate
SMILESCCC(C#N)c1cc(OCc2ccccc2)cc(C(=O)OC)c1
InChIInChI=1S/C19H19NO3/c1-3-15(12-20)16-9-17(19(21)22-2)11-18(10-16)23-13-14-7-5-4-6-8-14/h4-11,15H,3,13H2,1-2H3
InChIKeyMHWPLYUOTCVCSV-UHFFFAOYSA-N
XLogP4.07
TPSA59.32 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500309.37
LogP ≤ 54.07
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 3-(1-cyanopropyl)-5-phenylmethoxybenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-(1-cyanopropyl)-5-phenylmethoxybenzoate?
The IUPAC name of methyl 3-(1-cyanopropyl)-5-phenylmethoxybenzoate (CID 91040171) is methyl 3-(1-cyanopropyl)-5-phenylmethoxybenzoate.
What is the SMILES notation for methyl 3-(1-cyanopropyl)-5-phenylmethoxybenzoate?
The canonical SMILES for methyl 3-(1-cyanopropyl)-5-phenylmethoxybenzoate is CCC(C#N)c1cc(OCc2ccccc2)cc(C(=O)OC)c1.
What is the InChIKey of methyl 3-(1-cyanopropyl)-5-phenylmethoxybenzoate?
The InChIKey is MHWPLYUOTCVCSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19NO3/c1-3-15(12-20)16-9-17(19(21)22-2)11-18(10-16)23-13-14-7-5-4-6-8-14/h4-11,15H,3,13H2,1-2H3.
What are the key properties of methyl 3-(1-cyanopropyl)-5-phenylmethoxybenzoate?
methyl 3-(1-cyanopropyl)-5-phenylmethoxybenzoate has a molecular weight of 309.37 g/mol, XLogP of 4.07, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(1-cyanopropyl)-5-phenylmethoxybenzoate is sourced from PubChem (CID 91040171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).