C15H27NO3Si — CID 66988165
4-(2-amino-1-hydroxyethyl)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]phenol (PubChem CID 66988165) has the molecular formula C15H27NO3Si and a molecular weight of 297.47 g/mol. Its IUPAC name is 4-(2-amino-1-hydroxyethyl)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]phenol.
| Compound Name | 4-(2-amino-1-hydroxyethyl)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]phenol |
|---|---|
| PubChem CID | 66988165 |
| Molecular Formula | C15H27NO3Si |
| Molecular Weight | 297.47 g/mol |
| Exact Mass | 297.18 |
| IUPAC Name | 4-(2-amino-1-hydroxyethyl)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]phenol |
| SMILES | CC(C)(C)[Si](C)(C)OCc1cc(C(O)CN)ccc1O |
| InChI | InChI=1S/C15H27NO3Si/c1-15(2,3)20(4,5)19-10-12-8-11(14(18)9-16)6-7-13(12)17/h6-8,14,17-18H,9-10,16H2,1-5H3 |
| InChIKey | BZTQRYXFFPNTIB-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.47 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|