C14H21F3O3Si — CID 18700104
4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-(trifluoromethoxy)phenol (PubChem CID 18700104) has the molecular formula C14H21F3O3Si and a molecular weight of 322.40 g/mol. Its IUPAC name is 4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-(trifluoromethoxy)phenol.
| Compound Name | 4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-(trifluoromethoxy)phenol |
|---|---|
| PubChem CID | 18700104 |
| Molecular Formula | C14H21F3O3Si |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | 4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-(trifluoromethoxy)phenol |
| SMILES | CC(C)(C)[Si](C)(C)OCc1ccc(O)cc1OC(F)(F)F |
| InChI | InChI=1S/C14H21F3O3Si/c1-13(2,3)21(4,5)19-9-10-6-7-11(18)8-12(10)20-14(15,16)17/h6-8,18H,9H2,1-5H3 |
| InChIKey | JGELAMLPPFJVEG-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|