C28H35NO4Si — CID 18182272
[[6-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-phenylmethoxy-2-pyridinyl]-phenylmethyl] acetate (PubChem CID 18182272) has the molecular formula C28H35NO4Si and a molecular weight of 477.68 g/mol. Its IUPAC name is [[6-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-phenylmethoxy-2-pyridinyl]-phenylmethyl] acetate.
| Compound Name | [[6-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-phenylmethoxy-2-pyridinyl]-phenylmethyl] acetate |
|---|---|
| PubChem CID | 18182272 |
| Molecular Formula | C28H35NO4Si |
| Molecular Weight | 477.68 g/mol |
| Exact Mass | 477.23 |
| IUPAC Name | [[6-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-phenylmethoxy-2-pyridinyl]-phenylmethyl] acetate |
| SMILES | CC(=O)OC(c1ccccc1)c1nc(CO[Si](C)(C)C(C)(C)C)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C28H35NO4Si/c1-21(30)33-27(23-15-11-8-12-16-23)26-25(31-19-22-13-9-7-10-14-22)18-17-24(29-26)20-32-34(5,6)28(2,3)4/h7-18,27H,19-20H2,1-6H3 |
| InChIKey | VCJAJHPJXVKYKY-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.68 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|