C23H30O3 — CID 11078744
(2S,3S,4S)-4-methyl-3-phenylmethoxy-2-(phenylmethoxymethyl)hept-6-en-1-ol (PubChem CID 11078744) has the molecular formula C23H30O3 and a molecular weight of 354.49 g/mol. Its IUPAC name is (2S,3S,4S)-4-methyl-3-phenylmethoxy-2-(phenylmethoxymethyl)hept-6-en-1-ol.
| Compound Name | (2S,3S,4S)-4-methyl-3-phenylmethoxy-2-(phenylmethoxymethyl)hept-6-en-1-ol |
|---|---|
| PubChem CID | 11078744 |
| Molecular Formula | C23H30O3 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | (2S,3S,4S)-4-methyl-3-phenylmethoxy-2-(phenylmethoxymethyl)hept-6-en-1-ol |
| SMILES | C=CC[C@H](C)[C@H](OCc1ccccc1)[C@@H](CO)COCc1ccccc1 |
| InChI | InChI=1S/C23H30O3/c1-3-10-19(2)23(26-17-21-13-8-5-9-14-21)22(15-24)18-25-16-20-11-6-4-7-12-20/h3-9,11-14,19,22-24H,1,10,15-18H2,2H3/t19-,22-,23-/m0/s1 |
| InChIKey | WFXBHAYEKCTWLR-VJBMBRPKSA-N |
| XLogP | 4.61 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|