C30H36O5S — CID 10874868
[(2R,3S,4S)-4-methyl-3-phenylmethoxy-2-(phenylmethoxymethyl)hept-6-enyl] 4-methylbenzenesulfonate (PubChem CID 10874868) has the molecular formula C30H36O5S and a molecular weight of 508.68 g/mol. Its IUPAC name is [(2R,3S,4S)-4-methyl-3-phenylmethoxy-2-(phenylmethoxymethyl)hept-6-enyl] 4-methylbenzenesulfonate.
| Compound Name | [(2R,3S,4S)-4-methyl-3-phenylmethoxy-2-(phenylmethoxymethyl)hept-6-enyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10874868 |
| Molecular Formula | C30H36O5S |
| Molecular Weight | 508.68 g/mol |
| Exact Mass | 508.23 |
| IUPAC Name | [(2R,3S,4S)-4-methyl-3-phenylmethoxy-2-(phenylmethoxymethyl)hept-6-enyl] 4-methylbenzenesulfonate |
| SMILES | C=CC[C@H](C)[C@H](OCc1ccccc1)C(COCc1ccccc1)COS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C30H36O5S/c1-4-11-25(3)30(34-21-27-14-9-6-10-15-27)28(22-33-20-26-12-7-5-8-13-26)23-35-36(31,32)29-18-16-24(2)17-19-29/h4-10,12-19,25,28,30H,1,11,20-23H2,2-3H3/t25-,28?,30-/m0/s1 |
| InChIKey | RYVIYJSXTVUWSR-NFUCCUETSA-N |
| XLogP | 6.33 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.68 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|