C21H28O4S — CID 11360944
[(2S,3R)-2,4-dimethyl-3-phenylmethoxy(114C)pentyl] 4-methylbenzenesulfonate (PubChem CID 11360944) has the molecular formula C21H28O4S and a molecular weight of 378.51 g/mol. Its IUPAC name is [(2S,3R)-2,4-dimethyl-3-phenylmethoxy(114C)pentyl] 4-methylbenzenesulfonate.
| Compound Name | [(2S,3R)-2,4-dimethyl-3-phenylmethoxy(114C)pentyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 11360944 |
| Molecular Formula | C21H28O4S |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | [(2S,3R)-2,4-dimethyl-3-phenylmethoxy(114C)pentyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[14CH2][C@H](C)[C@H](OCc2ccccc2)C(C)C)cc1 |
| InChI | InChI=1S/C21H28O4S/c1-16(2)21(24-15-19-8-6-5-7-9-19)18(4)14-25-26(22,23)20-12-10-17(3)11-13-20/h5-13,16,18,21H,14-15H2,1-4H3/t18-,21+/m0/s1/i14+2 |
| InChIKey | NAIHKPIAXHHWHA-IASQSOOVSA-N |
| XLogP | 4.58 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|